C26H25FN4O4 — CID 166061247
3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-fluoro-4-[(3R)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-1H-indole-7-carboxamide (PubChem CID 166061247) has the molecular formula C26H25FN4O4 and a molecular weight of 476.51 g/mol. Its IUPAC name is 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-fluoro-4-[(3R)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-1H-indole-7-carboxamide.
| Compound Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-fluoro-4-[(3R)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 166061247 |
| Molecular Formula | C26H25FN4O4 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-fluoro-4-[(3R)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-1H-indole-7-carboxamide |
| SMILES | C=CC(=O)N[C@@H]1CCN(c2c(F)cc(C(N)=O)c3[nH]cc(C#Cc4cc(OC)cc(OC)c4)c23)C1 |
| InChI | InChI=1S/C26H25FN4O4/c1-4-22(32)30-17-7-8-31(14-17)25-21(27)12-20(26(28)33)24-23(25)16(13-29-24)6-5-15-9-18(34-2)11-19(10-15)35-3/h4,9-13,17,29H,1,7-8,14H2,2-3H3,(H2,28,33)(H,30,32)/t17-/m1/s1 |
| InChIKey | QQMVHNPPUYRUQR-QGZVFWFLSA-N |
| XLogP | 2.70 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|