C27H30F3N7O2 — CID 166061277
2-[2-(3-aminophenyl)-6-[[4-(trifluoromethoxy)-2-pyridinyl]amino]pyrimidin-4-yl]-N-methyl-2-azaspiro[4.5]decane-7-carboxamide (PubChem CID 166061277) has the molecular formula C27H30F3N7O2 and a molecular weight of 541.58 g/mol. Its IUPAC name is 2-[2-(3-aminophenyl)-6-[[4-(trifluoromethoxy)-2-pyridinyl]amino]pyrimidin-4-yl]-N-methyl-2-azaspiro[4.5]decane-7-carboxamide.
| Compound Name | 2-[2-(3-aminophenyl)-6-[[4-(trifluoromethoxy)-2-pyridinyl]amino]pyrimidin-4-yl]-N-methyl-2-azaspiro[4.5]decane-7-carboxamide |
|---|---|
| PubChem CID | 166061277 |
| Molecular Formula | C27H30F3N7O2 |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 2-[2-(3-aminophenyl)-6-[[4-(trifluoromethoxy)-2-pyridinyl]amino]pyrimidin-4-yl]-N-methyl-2-azaspiro[4.5]decane-7-carboxamide |
| SMILES | CNC(=O)C1CCCC2(CCN(c3cc(Nc4cc(OC(F)(F)F)ccn4)nc(-c4cccc(N)c4)n3)C2)C1 |
| InChI | InChI=1S/C27H30F3N7O2/c1-32-25(38)18-5-3-8-26(15-18)9-11-37(16-26)23-14-22(35-24(36-23)17-4-2-6-19(31)12-17)34-21-13-20(7-10-33-21)39-27(28,29)30/h2,4,6-7,10,12-14,18H,3,5,8-9,11,15-16,31H2,1H3,(H,32,38)(H,33,34,35,36) |
| InChIKey | CKTHEPGSVTWKSP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|