About N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide
N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide (PubChem CID 166062420) has the molecular formula C22H28N4O2
and a molecular weight of 380.49 g/mol. Its IUPAC name is N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide.
Molecular Properties
| Compound Name | N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide |
| PubChem CID | 166062420 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide |
| SMILES | CC1(C)CCN(c2ccc(Nc3ccc(CNC(=O)C(N)=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H28N4O2/c1-22(2)11-13-26(14-12-22)19-9-7-18(8-10-19)25-17-5-3-16(4-6-17)15-24-21(28)20(23)27/h3-10,25H,11-15H2,1-2H3,(H2,23,27)(H,24,28) |
| InChIKey | QZMAOTNVMHXSPF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide?
The IUPAC name of N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide (CID 166062420) is N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide.
What is the SMILES notation for N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide?
The canonical SMILES for N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide is CC1(C)CCN(c2ccc(Nc3ccc(CNC(=O)C(N)=O)cc3)cc2)CC1.
What is the InChIKey of N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide?
The InChIKey is QZMAOTNVMHXSPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N4O2/c1-22(2)11-13-26(14-12-22)19-9-7-18(8-10-19)25-17-5-3-16(4-6-17)15-24-21(28)20(23)27/h3-10,25H,11-15H2,1-2H3,(H2,23,27)(H,24,28).
What are the key properties of N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide?
N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide has a molecular weight of 380.49 g/mol, XLogP of 3.16, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[4-[4-(4,4-dimethylpiperidin-1-yl)anilino]phenyl]methyl]oxamide is sourced from PubChem (CID 166062420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).