C18H20O8 — CID 166062700
(7R,9R,11S)-9-tert-butyl-9-hydroxy-7-prop-2-ynoxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione (PubChem CID 166062700) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is (7R,9R,11S)-9-tert-butyl-9-hydroxy-7-prop-2-ynoxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione.
| Compound Name | (7R,9R,11S)-9-tert-butyl-9-hydroxy-7-prop-2-ynoxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione |
|---|---|
| PubChem CID | 166062700 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (7R,9R,11S)-9-tert-butyl-9-hydroxy-7-prop-2-ynoxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione |
| SMILES | C#CCOC1C(=O)OC2OC(=O)C34CC(=O)O[C@H]3C[C@@](O)(C(C)(C)C)C214 |
| InChI | InChI=1S/C18H20O8/c1-5-6-23-11-12(20)25-14-18(11)16(13(21)26-14)8-10(19)24-9(16)7-17(18,22)15(2,3)4/h1,9,11,14,22H,6-8H2,2-4H3/t9-,11?,14?,16?,17+,18?/m0/s1 |
| InChIKey | LBGUYLIOMPSWEI-XFVSKPCPSA-N |
| XLogP | -0.09 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|