C15H16F2N4O — CID 166062874
4-[(1S,2S,3R)-2-azido-1,3-difluoro-3-(oxan-4-yl)propyl]benzonitrile (PubChem CID 166062874) has the molecular formula C15H16F2N4O and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-[(1S,2S,3R)-2-azido-1,3-difluoro-3-(oxan-4-yl)propyl]benzonitrile.
| Compound Name | 4-[(1S,2S,3R)-2-azido-1,3-difluoro-3-(oxan-4-yl)propyl]benzonitrile |
|---|---|
| PubChem CID | 166062874 |
| Molecular Formula | C15H16F2N4O |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 4-[(1S,2S,3R)-2-azido-1,3-difluoro-3-(oxan-4-yl)propyl]benzonitrile |
| SMILES | N#Cc1ccc([C@H](F)[C@@H](N=[N+]=[N-])[C@H](F)C2CCOCC2)cc1 |
| InChI | InChI=1S/C15H16F2N4O/c16-13(11-3-1-10(9-18)2-4-11)15(20-21-19)14(17)12-5-7-22-8-6-12/h1-4,12-15H,5-8H2/t13-,14+,15+/m0/s1 |
| InChIKey | WBEXJRIZEXYZDT-RRFJBIMHSA-N |
| XLogP | 4.01 |
| TPSA | 81.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|