About N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide
N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide (PubChem CID 166062931) has the molecular formula C22H25N3O
and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide |
| PubChem CID | 166062931 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide |
| SMILES | O=C(NCCc1cccc(-c2cnc3[nH]ccc3c2)c1)C1CCCCC1 |
| InChI | InChI=1S/C22H25N3O/c26-22(17-6-2-1-3-7-17)24-11-9-16-5-4-8-18(13-16)20-14-19-10-12-23-21(19)25-15-20/h4-5,8,10,12-15,17H,1-3,6-7,9,11H2,(H,23,25)(H,24,26) |
| InChIKey | HQFREDDZGXQLOK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide?
The IUPAC name of N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide (CID 166062931) is N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide.
What is the SMILES notation for N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide?
The canonical SMILES for N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide is O=C(NCCc1cccc(-c2cnc3[nH]ccc3c2)c1)C1CCCCC1.
What is the InChIKey of N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide?
The InChIKey is HQFREDDZGXQLOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O/c26-22(17-6-2-1-3-7-17)24-11-9-16-5-4-8-18(13-16)20-14-19-10-12-23-21(19)25-15-20/h4-5,8,10,12-15,17H,1-3,6-7,9,11H2,(H,23,25)(H,24,26).
What are the key properties of N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide?
N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide has a molecular weight of 347.46 g/mol, XLogP of 4.47, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]ethyl]cyclohexanecarboxamide is sourced from PubChem (CID 166062931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).