About [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride
[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride (PubChem CID 166063089) has the molecular formula C11H20ClF3N2O2
and a molecular weight of 304.74 g/mol. Its IUPAC name is [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride.
Molecular Properties
| Compound Name | [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride |
| PubChem CID | 166063089 |
| Molecular Formula | C11H20ClF3N2O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride |
| SMILES | C[C@H](N)C(=O)OCC1CCN(CC(F)(F)F)CC1.Cl |
| InChI | InChI=1S/C11H19F3N2O2.ClH/c1-8(15)10(17)18-6-9-2-4-16(5-3-9)7-11(12,13)14;/h8-9H,2-7,15H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | XOUIDYLLGMLLSO-QRPNPIFTSA-N |
| XLogP | 1.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride?
The IUPAC name of [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride (CID 166063089) is [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride.
What is the SMILES notation for [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride?
The canonical SMILES for [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride is C[C@H](N)C(=O)OCC1CCN(CC(F)(F)F)CC1.Cl.
What is the InChIKey of [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride?
The InChIKey is XOUIDYLLGMLLSO-QRPNPIFTSA-N. The full InChI is InChI=1S/C11H19F3N2O2.ClH/c1-8(15)10(17)18-6-9-2-4-16(5-3-9)7-11(12,13)14;/h8-9H,2-7,15H2,1H3;1H/t8-;/m0./s1.
What are the key properties of [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride?
[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride has a molecular weight of 304.74 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl (2S)-2-aminopropanoate;hydrochloride is sourced from PubChem (CID 166063089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).