C14H11N5O2 — CID 166063201
ethyl 1-(3-cyano-1H-indazol-5-yl)pyrazole-4-carboxylate (PubChem CID 166063201) has the molecular formula C14H11N5O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is ethyl 1-(3-cyano-1H-indazol-5-yl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(3-cyano-1H-indazol-5-yl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 166063201 |
| Molecular Formula | C14H11N5O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | ethyl 1-(3-cyano-1H-indazol-5-yl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc3[nH]nc(C#N)c3c2)c1 |
| InChI | InChI=1S/C14H11N5O2/c1-2-21-14(20)9-7-16-19(8-9)10-3-4-12-11(5-10)13(6-15)18-17-12/h3-5,7-8H,2H2,1H3,(H,17,18) |
| InChIKey | BCZAMPRGEBKJQU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |