C60H60NP — CID 166063709
2-[[2,6-bis(4-benzhydryl-2,6-dimethylphenyl)phenyl]-tert-butylphosphanyl]-N,N-dimethylaniline (PubChem CID 166063709) has the molecular formula C60H60NP and a molecular weight of 826.12 g/mol. Its IUPAC name is 2-[[2,6-bis(4-benzhydryl-2,6-dimethylphenyl)phenyl]-tert-butylphosphanyl]-N,N-dimethylaniline.
| Compound Name | 2-[[2,6-bis(4-benzhydryl-2,6-dimethylphenyl)phenyl]-tert-butylphosphanyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 166063709 |
| Molecular Formula | C60H60NP |
| Molecular Weight | 826.12 g/mol |
| Exact Mass | 825.45 |
| IUPAC Name | 2-[[2,6-bis(4-benzhydryl-2,6-dimethylphenyl)phenyl]-tert-butylphosphanyl]-N,N-dimethylaniline |
| SMILES | Cc1cc(C(c2ccccc2)c2ccccc2)cc(C)c1-c1cccc(-c2c(C)cc(C(c3ccccc3)c3ccccc3)cc2C)c1P(c1ccccc1N(C)C)C(C)(C)C |
| InChI | InChI=1S/C60H60NP/c1-41-37-49(57(45-25-14-10-15-26-45)46-27-16-11-17-28-46)38-42(2)55(41)51-33-24-34-52(59(51)62(60(5,6)7)54-36-23-22-35-53(54)61(8)9)56-43(3)39-50(40-44(56)4)58(47-29-18-12-19-30-47)48-31-20-13-21-32-48/h10-40,57-58H,1-9H3 |
| InChIKey | FKWUNOUITWSHRQ-UHFFFAOYSA-N |
| XLogP | 14.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.12 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|