About 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one
2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one (PubChem CID 166064195) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one.
Molecular Properties
| Compound Name | 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one |
| PubChem CID | 166064195 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one |
| SMILES | CC/C=C/CCC1(C)CCC(C)(C)C1=O |
| InChI | InChI=1S/C14H24O/c1-5-6-7-8-9-14(4)11-10-13(2,3)12(14)15/h6-7H,5,8-11H2,1-4H3/b7-6+ |
| InChIKey | HJFRCEFKRCOBQB-VOTSOKGWSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one?
The IUPAC name of 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one (CID 166064195) is 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one.
What is the SMILES notation for 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one?
The canonical SMILES for 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one is CC/C=C/CCC1(C)CCC(C)(C)C1=O.
What is the InChIKey of 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one?
The InChIKey is HJFRCEFKRCOBQB-VOTSOKGWSA-N. The full InChI is InChI=1S/C14H24O/c1-5-6-7-8-9-14(4)11-10-13(2,3)12(14)15/h6-7H,5,8-11H2,1-4H3/b7-6+.
What are the key properties of 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one?
2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one has a molecular weight of 208.34 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-hex-3-enyl]-2,5,5-trimethylcyclopentan-1-one is sourced from PubChem (CID 166064195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).