C18H15ClN4OS — CID 166064762
7-benzyl-3-(4-chlorophenyl)-2,4-dihydro-[1,2,4]triazino[3,2-b][1,3,5]thiadiazin-8-one (PubChem CID 166064762) has the molecular formula C18H15ClN4OS and a molecular weight of 370.87 g/mol. Its IUPAC name is 7-benzyl-3-(4-chlorophenyl)-2,4-dihydro-[1,2,4]triazino[3,2-b][1,3,5]thiadiazin-8-one.
| Compound Name | 7-benzyl-3-(4-chlorophenyl)-2,4-dihydro-[1,2,4]triazino[3,2-b][1,3,5]thiadiazin-8-one |
|---|---|
| PubChem CID | 166064762 |
| Molecular Formula | C18H15ClN4OS |
| Molecular Weight | 370.87 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 7-benzyl-3-(4-chlorophenyl)-2,4-dihydro-[1,2,4]triazino[3,2-b][1,3,5]thiadiazin-8-one |
| SMILES | O=c1nc2n(nc1Cc1ccccc1)CN(c1ccc(Cl)cc1)CS2 |
| InChI | InChI=1S/C18H15ClN4OS/c19-14-6-8-15(9-7-14)22-11-23-18(25-12-22)20-17(24)16(21-23)10-13-4-2-1-3-5-13/h1-9H,10-12H2 |
| InChIKey | CRCATDIPMGZRRT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |