About 1-oct-1-enoxypropan-1-ol
1-oct-1-enoxypropan-1-ol (PubChem CID 166065599) has the molecular formula C11H22O2
and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-oct-1-enoxypropan-1-ol.
Molecular Properties
| Compound Name | 1-oct-1-enoxypropan-1-ol |
| PubChem CID | 166065599 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 1-oct-1-enoxypropan-1-ol |
| SMILES | CCCCCCC=COC(O)CC |
| InChI | InChI=1S/C11H22O2/c1-3-5-6-7-8-9-10-13-11(12)4-2/h9-12H,3-8H2,1-2H3 |
| InChIKey | DDNZPUNREFKHAW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-oct-1-enoxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oct-1-enoxypropan-1-ol?
The IUPAC name of 1-oct-1-enoxypropan-1-ol (CID 166065599) is 1-oct-1-enoxypropan-1-ol.
What is the SMILES notation for 1-oct-1-enoxypropan-1-ol?
The canonical SMILES for 1-oct-1-enoxypropan-1-ol is CCCCCCC=COC(O)CC.
What is the InChIKey of 1-oct-1-enoxypropan-1-ol?
The InChIKey is DDNZPUNREFKHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-3-5-6-7-8-9-10-13-11(12)4-2/h9-12H,3-8H2,1-2H3.
What are the key properties of 1-oct-1-enoxypropan-1-ol?
1-oct-1-enoxypropan-1-ol has a molecular weight of 186.30 g/mol, XLogP of 3.22, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oct-1-enoxypropan-1-ol is sourced from PubChem (CID 166065599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).