About 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine
7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine (PubChem CID 166066017) has the molecular formula C15H12F2N2O3
and a molecular weight of 306.27 g/mol. Its IUPAC name is 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine |
| PubChem CID | 166066017 |
| Molecular Formula | C15H12F2N2O3 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine |
| SMILES | COc1ccc(F)c(F)c1COc1cc(N)cc2ncoc12 |
| InChI | InChI=1S/C15H12F2N2O3/c1-20-12-3-2-10(16)14(17)9(12)6-21-13-5-8(18)4-11-15(13)22-7-19-11/h2-5,7H,6,18H2,1H3 |
| InChIKey | JADRZQZWBMXXRC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine?
The IUPAC name of 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine (CID 166066017) is 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine.
What is the SMILES notation for 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine?
The canonical SMILES for 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine is COc1ccc(F)c(F)c1COc1cc(N)cc2ncoc12.
What is the InChIKey of 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine?
The InChIKey is JADRZQZWBMXXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2O3/c1-20-12-3-2-10(16)14(17)9(12)6-21-13-5-8(18)4-11-15(13)22-7-19-11/h2-5,7H,6,18H2,1H3.
What are the key properties of 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine?
7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine has a molecular weight of 306.27 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2,3-difluoro-6-methoxyphenyl)methoxy]-1,3-benzoxazol-5-amine is sourced from PubChem (CID 166066017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).