C14H19BrN2O3 — CID 166066403
methyl 1-[(2-bromo-3-methoxy-4-pyridinyl)methyl]piperidine-4-carboxylate (PubChem CID 166066403) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is methyl 1-[(2-bromo-3-methoxy-4-pyridinyl)methyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(2-bromo-3-methoxy-4-pyridinyl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 166066403 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | methyl 1-[(2-bromo-3-methoxy-4-pyridinyl)methyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(Cc2ccnc(Br)c2OC)CC1 |
| InChI | InChI=1S/C14H19BrN2O3/c1-19-12-11(3-6-16-13(12)15)9-17-7-4-10(5-8-17)14(18)20-2/h3,6,10H,4-5,7-9H2,1-2H3 |
| InChIKey | MHKWGVPMGKLZSU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|