C18H15F3N4O4 — CID 166067084
4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-2,5-dimethyl-6-nitropyrano[2,3-d]pyrimidin-7-one (PubChem CID 166067084) has the molecular formula C18H15F3N4O4 and a molecular weight of 408.34 g/mol. Its IUPAC name is 4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-2,5-dimethyl-6-nitropyrano[2,3-d]pyrimidin-7-one.
| Compound Name | 4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-2,5-dimethyl-6-nitropyrano[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 166067084 |
| Molecular Formula | C18H15F3N4O4 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-2,5-dimethyl-6-nitropyrano[2,3-d]pyrimidin-7-one |
| SMILES | Cc1nc(N[C@H](C)c2cccc(C(F)F)c2F)c2c(C)c([N+](=O)[O-])c(=O)oc2n1 |
| InChI | InChI=1S/C18H15F3N4O4/c1-7-12-16(22-8(2)10-5-4-6-11(13(10)19)15(20)21)23-9(3)24-17(12)29-18(26)14(7)25(27)28/h4-6,8,15H,1-3H3,(H,22,23,24)/t8-/m1/s1 |
| InChIKey | VSGVIESJEPBBGC-MRVPVSSYSA-N |
| XLogP | 4.36 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|