C27H24FN5O6S2 — CID 166067142
N-(2-fluoro-3-methylsulfonylphenyl)-5-methyl-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-7-nitroindol-3-yl]pyrimidin-2-amine (PubChem CID 166067142) has the molecular formula C27H24FN5O6S2 and a molecular weight of 597.65 g/mol. Its IUPAC name is N-(2-fluoro-3-methylsulfonylphenyl)-5-methyl-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-7-nitroindol-3-yl]pyrimidin-2-amine.
| Compound Name | N-(2-fluoro-3-methylsulfonylphenyl)-5-methyl-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-7-nitroindol-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 166067142 |
| Molecular Formula | C27H24FN5O6S2 |
| Molecular Weight | 597.65 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | N-(2-fluoro-3-methylsulfonylphenyl)-5-methyl-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-7-nitroindol-3-yl]pyrimidin-2-amine |
| SMILES | Cc1cnc(Nc2cccc(S(C)(=O)=O)c2F)nc1-c1cn(S(=O)(=O)C2(C)C=CC=CC2)c2c([N+](=O)[O-])cccc12 |
| InChI | InChI=1S/C27H24FN5O6S2/c1-17-15-29-26(30-20-10-8-12-22(23(20)28)40(3,36)37)31-24(17)19-16-32(25-18(19)9-7-11-21(25)33(34)35)41(38,39)27(2)13-5-4-6-14-27/h4-13,15-16H,14H2,1-3H3,(H,29,30,31) |
| InChIKey | WUBCXGVRCPYGIJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 154.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|