About 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione
3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione (PubChem CID 166067655) has the molecular formula C13H13F2NO3
and a molecular weight of 269.25 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione.
Molecular Properties
| Compound Name | 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione |
| PubChem CID | 166067655 |
| Molecular Formula | C13H13F2NO3 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2c(F)cc(CCO)cc2F)C(=O)N1 |
| InChI | InChI=1S/C13H13F2NO3/c14-9-5-7(3-4-17)6-10(15)12(9)8-1-2-11(18)16-13(8)19/h5-6,8,17H,1-4H2,(H,16,18,19) |
| InChIKey | PAYOGWXPXRDYEO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione?
The IUPAC name of 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione (CID 166067655) is 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione.
What is the SMILES notation for 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione?
The canonical SMILES for 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione is O=C1CCC(c2c(F)cc(CCO)cc2F)C(=O)N1.
What is the InChIKey of 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione?
The InChIKey is PAYOGWXPXRDYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2NO3/c14-9-5-7(3-4-17)6-10(15)12(9)8-1-2-11(18)16-13(8)19/h5-6,8,17H,1-4H2,(H,16,18,19).
What are the key properties of 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione?
3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione has a molecular weight of 269.25 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]piperidine-2,6-dione is sourced from PubChem (CID 166067655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).