C22H24ClN3O5S2 — CID 166068006
5-chloro-N-[2-(cyclopropylsulfonylamino)ethyl]-3-(3,5-dimethylphenyl)sulfonyl-1H-indole-2-carboxamide (PubChem CID 166068006) has the molecular formula C22H24ClN3O5S2 and a molecular weight of 510.04 g/mol. Its IUPAC name is 5-chloro-N-[2-(cyclopropylsulfonylamino)ethyl]-3-(3,5-dimethylphenyl)sulfonyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(cyclopropylsulfonylamino)ethyl]-3-(3,5-dimethylphenyl)sulfonyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166068006 |
| Molecular Formula | C22H24ClN3O5S2 |
| Molecular Weight | 510.04 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 5-chloro-N-[2-(cyclopropylsulfonylamino)ethyl]-3-(3,5-dimethylphenyl)sulfonyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)c2c(C(=O)NCCNS(=O)(=O)C3CC3)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C22H24ClN3O5S2/c1-13-9-14(2)11-17(10-13)32(28,29)21-18-12-15(23)3-6-19(18)26-20(21)22(27)24-7-8-25-33(30,31)16-4-5-16/h3,6,9-12,16,25-26H,4-5,7-8H2,1-2H3,(H,24,27) |
| InChIKey | ZUTRKLYUHBWZCX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.04 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|