C22H39BO3Si — CID 166068216
tert-butyl-[[6-di(propan-2-yloxy)boranyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]-dimethylsilane (PubChem CID 166068216) has the molecular formula C22H39BO3Si and a molecular weight of 390.45 g/mol. Its IUPAC name is tert-butyl-[[6-di(propan-2-yloxy)boranyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[6-di(propan-2-yloxy)boranyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 166068216 |
| Molecular Formula | C22H39BO3Si |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | tert-butyl-[[6-di(propan-2-yloxy)boranyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]-dimethylsilane |
| SMILES | CC(C)OB(OC(C)C)c1ccc2c(c1)CCC(O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C22H39BO3Si/c1-16(2)24-23(25-17(3)4)20-12-10-19-15-21(13-11-18(19)14-20)26-27(8,9)22(5,6)7/h10,12,14,16-17,21H,11,13,15H2,1-9H3 |
| InChIKey | NWWJTGONYOTDAY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|