About tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane
tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane (PubChem CID 166068280) has the molecular formula C23H31F2NOSi
and a molecular weight of 403.59 g/mol. Its IUPAC name is tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane |
| PubChem CID | 166068280 |
| Molecular Formula | C23H31F2NOSi |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC1CCCN(CC(F)F)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31F2NOSi/c1-23(2,3)28(20-12-6-4-7-13-20,21-14-8-5-9-15-21)27-19-11-10-16-26(17-19)18-22(24)25/h4-9,12-15,19,22H,10-11,16-18H2,1-3H3 |
| InChIKey | DQZSBJNSSXELKT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane?
The IUPAC name of tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane (CID 166068280) is tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane.
What is the SMILES notation for tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane?
The canonical SMILES for tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane is CC(C)(C)[Si](OC1CCCN(CC(F)F)C1)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane?
The InChIKey is DQZSBJNSSXELKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31F2NOSi/c1-23(2,3)28(20-12-6-4-7-13-20,21-14-8-5-9-15-21)27-19-11-10-16-26(17-19)18-22(24)25/h4-9,12-15,19,22H,10-11,16-18H2,1-3H3.
What are the key properties of tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane?
tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane has a molecular weight of 403.59 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[1-(2,2-difluoroethyl)piperidin-3-yl]oxy-diphenylsilane is sourced from PubChem (CID 166068280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).