About 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide
3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide (PubChem CID 166070006) has the molecular formula C8H6ClN3O
and a molecular weight of 195.61 g/mol. Its IUPAC name is 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide |
| PubChem CID | 166070006 |
| Molecular Formula | C8H6ClN3O |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]cc(Cl)c2n1 |
| InChI | InChI=1S/C8H6ClN3O/c9-4-3-11-5-1-2-6(8(10)13)12-7(4)5/h1-3,11H,(H2,10,13) |
| InChIKey | FKMAFKZQKNOXDR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide?
The IUPAC name of 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide (CID 166070006) is 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide.
What is the SMILES notation for 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide?
The canonical SMILES for 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide is NC(=O)c1ccc2[nH]cc(Cl)c2n1.
What is the InChIKey of 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide?
The InChIKey is FKMAFKZQKNOXDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN3O/c9-4-3-11-5-1-2-6(8(10)13)12-7(4)5/h1-3,11H,(H2,10,13).
What are the key properties of 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide?
3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide has a molecular weight of 195.61 g/mol, XLogP of 1.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxamide is sourced from PubChem (CID 166070006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).