C33H41ClN4OSi — CID 166070450
9-chloro-6,6-dimethyl-8-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-(2-trimethylsilylethynyl)-5H-benzo[b]carbazol-11-one (PubChem CID 166070450) has the molecular formula C33H41ClN4OSi and a molecular weight of 573.26 g/mol. Its IUPAC name is 9-chloro-6,6-dimethyl-8-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-(2-trimethylsilylethynyl)-5H-benzo[b]carbazol-11-one.
| Compound Name | 9-chloro-6,6-dimethyl-8-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-(2-trimethylsilylethynyl)-5H-benzo[b]carbazol-11-one |
|---|---|
| PubChem CID | 166070450 |
| Molecular Formula | C33H41ClN4OSi |
| Molecular Weight | 573.26 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 9-chloro-6,6-dimethyl-8-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-(2-trimethylsilylethynyl)-5H-benzo[b]carbazol-11-one |
| SMILES | CN1CCN(C2CCN(c3cc4c(cc3Cl)C(=O)c3c([nH]c5cc(C#C[Si](C)(C)C)ccc35)C4(C)C)CC2)CC1 |
| InChI | InChI=1S/C33H41ClN4OSi/c1-33(2)26-21-29(38-12-9-23(10-13-38)37-16-14-36(3)15-17-37)27(34)20-25(26)31(39)30-24-8-7-22(11-18-40(4,5)6)19-28(24)35-32(30)33/h7-8,19-21,23,35H,9-10,12-17H2,1-6H3 |
| InChIKey | OXKUNXBIBBUNOC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.26 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|