C15H15N3O — CID 166071235
3-(4,5-dihydro-1H-imidazol-2-yl)-2-methoxy-6-phenylpyridine (PubChem CID 166071235) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methoxy-6-phenylpyridine.
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methoxy-6-phenylpyridine |
|---|---|
| PubChem CID | 166071235 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methoxy-6-phenylpyridine |
| SMILES | COc1nc(-c2ccccc2)ccc1C1=NCCN1 |
| InChI | InChI=1S/C15H15N3O/c1-19-15-12(14-16-9-10-17-14)7-8-13(18-15)11-5-3-2-4-6-11/h2-8H,9-10H2,1H3,(H,16,17) |
| InChIKey | NCTAJROHGPEDGY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |