About N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide
N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide (PubChem CID 166072120) has the molecular formula C18H25N3O2
and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide |
| PubChem CID | 166072120 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide |
| SMILES | Cc1cccc2c(C(C)(C)NC(=O)C[C@@H]3CCCN3C)noc12 |
| InChI | InChI=1S/C18H25N3O2/c1-12-7-5-9-14-16(12)23-20-17(14)18(2,3)19-15(22)11-13-8-6-10-21(13)4/h5,7,9,13H,6,8,10-11H2,1-4H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | MYAPOWQYRDNLGO-ZDUSSCGKSA-N |
| XLogP | 2.97 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide?
The IUPAC name of N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide (CID 166072120) is N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide.
What is the SMILES notation for N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide?
The canonical SMILES for N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide is Cc1cccc2c(C(C)(C)NC(=O)C[C@@H]3CCCN3C)noc12.
What is the InChIKey of N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide?
The InChIKey is MYAPOWQYRDNLGO-ZDUSSCGKSA-N. The full InChI is InChI=1S/C18H25N3O2/c1-12-7-5-9-14-16(12)23-20-17(14)18(2,3)19-15(22)11-13-8-6-10-21(13)4/h5,7,9,13H,6,8,10-11H2,1-4H3,(H,19,22)/t13-/m0/s1.
What are the key properties of N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide?
N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide has a molecular weight of 315.42 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(7-methyl-1,2-benzoxazol-3-yl)propan-2-yl]-2-[(2S)-1-methylpyrrolidin-2-yl]acetamide is sourced from PubChem (CID 166072120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).