C28H24N4O — CID 166072349
(8R)-6-benzyl-8-ethenyl-2,9-diphenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one (PubChem CID 166072349) has the molecular formula C28H24N4O and a molecular weight of 432.53 g/mol. Its IUPAC name is (8R)-6-benzyl-8-ethenyl-2,9-diphenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one.
| Compound Name | (8R)-6-benzyl-8-ethenyl-2,9-diphenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 166072349 |
| Molecular Formula | C28H24N4O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (8R)-6-benzyl-8-ethenyl-2,9-diphenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one |
| SMILES | C=C[C@@H]1CN(Cc2ccccc2)C(=O)c2cnc(-c3ccccc3)nc2N1c1ccccc1 |
| InChI | InChI=1S/C28H24N4O/c1-2-23-20-31(19-21-12-6-3-7-13-21)28(33)25-18-29-26(22-14-8-4-9-15-22)30-27(25)32(23)24-16-10-5-11-17-24/h2-18,23H,1,19-20H2/t23-/m1/s1 |
| InChIKey | VDEIMTCKWAWIFM-HSZRJFAPSA-N |
| XLogP | 5.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|