C19H8F6O9 — CID 166072354
5,6-bis(trifluoromethyl)-9H-xanthene-1,2,3,4-tetracarboxylic acid (PubChem CID 166072354) has the molecular formula C19H8F6O9 and a molecular weight of 494.25 g/mol. Its IUPAC name is 5,6-bis(trifluoromethyl)-9H-xanthene-1,2,3,4-tetracarboxylic acid.
| Compound Name | 5,6-bis(trifluoromethyl)-9H-xanthene-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 166072354 |
| Molecular Formula | C19H8F6O9 |
| Molecular Weight | 494.25 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 5,6-bis(trifluoromethyl)-9H-xanthene-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)c1c2c(c(C(=O)O)c(C(=O)O)c1C(=O)O)Oc1c(ccc(C(F)(F)F)c1C(F)(F)F)C2 |
| InChI | InChI=1S/C19H8F6O9/c20-18(21,22)6-2-1-4-3-5-7(14(26)27)8(15(28)29)9(16(30)31)10(17(32)33)13(5)34-12(4)11(6)19(23,24)25/h1-2H,3H2,(H,26,27)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | HBFNTKRMEWYVBR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |