C10H20O7S — CID 166072551
(2R,3S,4S,5S,6R)-2-butylsulfonyl-6-methyloxane-2,3,4,5-tetrol (PubChem CID 166072551) has the molecular formula C10H20O7S and a molecular weight of 284.33 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-butylsulfonyl-6-methyloxane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4S,5S,6R)-2-butylsulfonyl-6-methyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 166072551 |
| Molecular Formula | C10H20O7S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-butylsulfonyl-6-methyloxane-2,3,4,5-tetrol |
| SMILES | CCCCS(=O)(=O)[C@]1(O)O[C@H](C)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H20O7S/c1-3-4-5-18(15,16)10(14)9(13)8(12)7(11)6(2)17-10/h6-9,11-14H,3-5H2,1-2H3/t6-,7-,8+,9+,10-/m1/s1 |
| InChIKey | QRAKJULFNPOLEZ-FHNUBNKASA-N |
| XLogP | -1.65 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |