C18H19BrFN4OP — CID 166073130
N-[(1R)-1-(3-bromo-2-fluorophenyl)ethyl]-6-dimethylphosphoryl-2-methylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 166073130) has the molecular formula C18H19BrFN4OP and a molecular weight of 437.25 g/mol. Its IUPAC name is N-[(1R)-1-(3-bromo-2-fluorophenyl)ethyl]-6-dimethylphosphoryl-2-methylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[(1R)-1-(3-bromo-2-fluorophenyl)ethyl]-6-dimethylphosphoryl-2-methylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166073130 |
| Molecular Formula | C18H19BrFN4OP |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-[(1R)-1-(3-bromo-2-fluorophenyl)ethyl]-6-dimethylphosphoryl-2-methylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cccc(Br)c2F)c2cc(P(C)(C)=O)ncc2n1 |
| InChI | InChI=1S/C18H19BrFN4OP/c1-10(12-6-5-7-14(19)17(12)20)22-18-13-8-16(26(3,4)25)21-9-15(13)23-11(2)24-18/h5-10H,1-4H3,(H,22,23,24)/t10-/m1/s1 |
| InChIKey | COZMQPYCQTYGEK-SNVBAGLBSA-N |
| XLogP | 4.66 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|