C20H28S — CID 166073422
1-methyl-4-[(E)-5-(2-methylprop-2-enylsulfanyl)-4-prop-1-en-2-ylhex-4-en-3-yl]benzene (PubChem CID 166073422) has the molecular formula C20H28S and a molecular weight of 300.51 g/mol. Its IUPAC name is 1-methyl-4-[(E)-5-(2-methylprop-2-enylsulfanyl)-4-prop-1-en-2-ylhex-4-en-3-yl]benzene.
| Compound Name | 1-methyl-4-[(E)-5-(2-methylprop-2-enylsulfanyl)-4-prop-1-en-2-ylhex-4-en-3-yl]benzene |
|---|---|
| PubChem CID | 166073422 |
| Molecular Formula | C20H28S |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1-methyl-4-[(E)-5-(2-methylprop-2-enylsulfanyl)-4-prop-1-en-2-ylhex-4-en-3-yl]benzene |
| SMILES | C=C(C)CS/C(C)=C(/C(=C)C)C(CC)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H28S/c1-8-19(18-11-9-16(6)10-12-18)20(15(4)5)17(7)21-13-14(2)3/h9-12,19H,2,4,8,13H2,1,3,5-7H3/b20-17- |
| InChIKey | AXIYMZQICHRQJD-JZJYNLBNSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|