About 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine
6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine (PubChem CID 166073434) has the molecular formula C15H17F2NO2
and a molecular weight of 281.30 g/mol. Its IUPAC name is 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine.
Molecular Properties
| Compound Name | 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine |
| PubChem CID | 166073434 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine |
| SMILES | Nc1cc(/C=C/C2CCC(F)(F)CC2)cc2c1OCO2 |
| InChI | InChI=1S/C15H17F2NO2/c16-15(17)5-3-10(4-6-15)1-2-11-7-12(18)14-13(8-11)19-9-20-14/h1-2,7-8,10H,3-6,9,18H2/b2-1+ |
| InChIKey | JTVMVMAINMSEJM-OWOJBTEDSA-N |
| XLogP | 3.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine?
The IUPAC name of 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine (CID 166073434) is 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine.
What is the SMILES notation for 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine?
The canonical SMILES for 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine is Nc1cc(/C=C/C2CCC(F)(F)CC2)cc2c1OCO2.
What is the InChIKey of 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine?
The InChIKey is JTVMVMAINMSEJM-OWOJBTEDSA-N. The full InChI is InChI=1S/C15H17F2NO2/c16-15(17)5-3-10(4-6-15)1-2-11-7-12(18)14-13(8-11)19-9-20-14/h1-2,7-8,10H,3-6,9,18H2/b2-1+.
What are the key properties of 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine?
6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine has a molecular weight of 281.30 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-1,3-benzodioxol-4-amine is sourced from PubChem (CID 166073434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).