About ethane;5-ethyl-1-methylpyrimidine-2,4-dione
ethane;5-ethyl-1-methylpyrimidine-2,4-dione (PubChem CID 166074959) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is ethane;5-ethyl-1-methylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | ethane;5-ethyl-1-methylpyrimidine-2,4-dione |
| PubChem CID | 166074959 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | ethane;5-ethyl-1-methylpyrimidine-2,4-dione |
| SMILES | CC.CCc1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H10N2O2.C2H6/c1-3-5-4-9(2)7(11)8-6(5)10;1-2/h4H,3H2,1-2H3,(H,8,10,11);1-2H3 |
| InChIKey | XZKKQSVQKANEBT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-ethyl-1-methylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-1-methylpyrimidine-2,4-dione?
The IUPAC name of ethane;5-ethyl-1-methylpyrimidine-2,4-dione (CID 166074959) is ethane;5-ethyl-1-methylpyrimidine-2,4-dione.
What is the SMILES notation for ethane;5-ethyl-1-methylpyrimidine-2,4-dione?
The canonical SMILES for ethane;5-ethyl-1-methylpyrimidine-2,4-dione is CC.CCc1cn(C)c(=O)[nH]c1=O.
What is the InChIKey of ethane;5-ethyl-1-methylpyrimidine-2,4-dione?
The InChIKey is XZKKQSVQKANEBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2.C2H6/c1-3-5-4-9(2)7(11)8-6(5)10;1-2/h4H,3H2,1-2H3,(H,8,10,11);1-2H3.
What are the key properties of ethane;5-ethyl-1-methylpyrimidine-2,4-dione?
ethane;5-ethyl-1-methylpyrimidine-2,4-dione has a molecular weight of 184.24 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-1-methylpyrimidine-2,4-dione is sourced from PubChem (CID 166074959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).