C11H25F2NO — CID 166075469
(3,3-difluoro-1-methylpiperidin-4-yl)methanol;ethane (PubChem CID 166075469) has the molecular formula C11H25F2NO and a molecular weight of 225.32 g/mol. Its IUPAC name is (3,3-difluoro-1-methylpiperidin-4-yl)methanol;ethane.
| Compound Name | (3,3-difluoro-1-methylpiperidin-4-yl)methanol;ethane |
|---|---|
| PubChem CID | 166075469 |
| Molecular Formula | C11H25F2NO |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | (3,3-difluoro-1-methylpiperidin-4-yl)methanol;ethane |
| SMILES | CC.CC.CN1CCC(CO)C(F)(F)C1 |
| InChI | InChI=1S/C7H13F2NO.2C2H6/c1-10-3-2-6(4-11)7(8,9)5-10;2*1-2/h6,11H,2-5H2,1H3;2*1-2H3 |
| InChIKey | UNPDOBGIBWTTSX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |