C13H11ClF2N2 — CID 166075690
3-chloro-5-(1,1-difluoroethyl)-6-ethynyl-2,7-dimethyl-1H-pyrrolo[3,2-b]pyridine (PubChem CID 166075690) has the molecular formula C13H11ClF2N2 and a molecular weight of 268.69 g/mol. Its IUPAC name is 3-chloro-5-(1,1-difluoroethyl)-6-ethynyl-2,7-dimethyl-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | 3-chloro-5-(1,1-difluoroethyl)-6-ethynyl-2,7-dimethyl-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 166075690 |
| Molecular Formula | C13H11ClF2N2 |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-chloro-5-(1,1-difluoroethyl)-6-ethynyl-2,7-dimethyl-1H-pyrrolo[3,2-b]pyridine |
| SMILES | C#Cc1c(C(C)(F)F)nc2c(Cl)c(C)[nH]c2c1C |
| InChI | InChI=1S/C13H11ClF2N2/c1-5-8-6(2)10-11(9(14)7(3)17-10)18-12(8)13(4,15)16/h1,17H,2-4H3 |
| InChIKey | XFFCKJQHHMECRC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|