C15H19NO4 — CID 166076274
methyl 6-[(2E,4E)-4-(hydroxymethyl)hepta-2,4-dien-2-yl]oxypyridine-3-carboxylate (PubChem CID 166076274) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl 6-[(2E,4E)-4-(hydroxymethyl)hepta-2,4-dien-2-yl]oxypyridine-3-carboxylate.
| Compound Name | methyl 6-[(2E,4E)-4-(hydroxymethyl)hepta-2,4-dien-2-yl]oxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 166076274 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | methyl 6-[(2E,4E)-4-(hydroxymethyl)hepta-2,4-dien-2-yl]oxypyridine-3-carboxylate |
| SMILES | CC/C=C(\C=C(/C)Oc1ccc(C(=O)OC)cn1)CO |
| InChI | InChI=1S/C15H19NO4/c1-4-5-12(10-17)8-11(2)20-14-7-6-13(9-16-14)15(18)19-3/h5-9,17H,4,10H2,1-3H3/b11-8+,12-5+ |
| InChIKey | HRVSIGPSVCTNQR-OEBNHILSSA-N |
| XLogP | 2.48 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|