About CID 166076399
CID 166076399 (PubChem CID 166076399) has the molecular formula C22H15B2F3N4O
and a molecular weight of 430.01 g/mol.
Molecular Properties
| Compound Name | CID 166076399 |
| PubChem CID | 166076399 |
| Molecular Formula | C22H15B2F3N4O |
| Molecular Weight | 430.01 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | — |
| SMILES | [B]C12B(F)c3cc(-c4cc(F)cc(N)c4/C=N/C)cc(F)c3CN1C(=O)c1cccnc12 |
| InChI | InChI=1S/C22H15B2F3N4O/c1-29-9-15-14(7-12(25)8-19(15)28)11-5-17-16(18(26)6-11)10-31-21(32)13-3-2-4-30-20(13)22(31,23)24(17)27/h2-9H,10,28H2,1H3/b29-9+ |
| InChIKey | SFRWWKSIGKSPRA-GESPGMLMSA-N |
| XLogP | 2.36 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.01 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 166076399 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166076399?
The IUPAC name of CID 166076399 (CID 166076399) is not available.
What is the SMILES notation for CID 166076399?
The canonical SMILES for CID 166076399 is [B]C12B(F)c3cc(-c4cc(F)cc(N)c4/C=N/C)cc(F)c3CN1C(=O)c1cccnc12.
What is the InChIKey of CID 166076399?
The InChIKey is SFRWWKSIGKSPRA-GESPGMLMSA-N. The full InChI is InChI=1S/C22H15B2F3N4O/c1-29-9-15-14(7-12(25)8-19(15)28)11-5-17-16(18(26)6-11)10-31-21(32)13-3-2-4-30-20(13)22(31,23)24(17)27/h2-9H,10,28H2,1H3/b29-9+.
What are the key properties of CID 166076399?
CID 166076399 has a molecular weight of 430.01 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166076399 is sourced from PubChem (CID 166076399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).