About CID 166076400
CID 166076400 (PubChem CID 166076400) has the molecular formula C28H24BF2N5O2
and a molecular weight of 511.34 g/mol.
Molecular Properties
| Compound Name | CID 166076400 |
| PubChem CID | 166076400 |
| Molecular Formula | C28H24BF2N5O2 |
| Molecular Weight | 511.34 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | — |
| SMILES | [B]C1(O)c2ncccc2C(=O)N1Cc1c(F)cc(-c2ccc(CCC3(C#N)CC3)c(N)c2/C=N/C)cc1F |
| InChI | InChI=1S/C28H24BF2N5O2/c1-34-13-20-18(5-4-16(24(20)33)6-7-27(15-32)8-9-27)17-11-22(30)21(23(31)12-17)14-36-26(37)19-3-2-10-35-25(19)28(36,29)38/h2-5,10-13,38H,6-9,14,33H2,1H3/b34-13+ |
| InChIKey | XVKFQVMXZNWNAL-RPUDKEGQSA-N |
| XLogP | 3.82 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 166076400 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166076400?
The IUPAC name of CID 166076400 (CID 166076400) is not available.
What is the SMILES notation for CID 166076400?
The canonical SMILES for CID 166076400 is [B]C1(O)c2ncccc2C(=O)N1Cc1c(F)cc(-c2ccc(CCC3(C#N)CC3)c(N)c2/C=N/C)cc1F.
What is the InChIKey of CID 166076400?
The InChIKey is XVKFQVMXZNWNAL-RPUDKEGQSA-N. The full InChI is InChI=1S/C28H24BF2N5O2/c1-34-13-20-18(5-4-16(24(20)33)6-7-27(15-32)8-9-27)17-11-22(30)21(23(31)12-17)14-36-26(37)19-3-2-10-35-25(19)28(36,29)38/h2-5,10-13,38H,6-9,14,33H2,1H3/b34-13+.
What are the key properties of CID 166076400?
CID 166076400 has a molecular weight of 511.34 g/mol, XLogP of 3.82, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166076400 is sourced from PubChem (CID 166076400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).