About CID 166076513
CID 166076513 (PubChem CID 166076513) has the molecular formula C27H28B2F2N4O2
and a molecular weight of 500.17 g/mol.
Molecular Properties
| Compound Name | CID 166076513 |
| PubChem CID | 166076513 |
| Molecular Formula | C27H28B2F2N4O2 |
| Molecular Weight | 500.17 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1ncccc1C=O)N(C)Cc1c(F)cc(-c2ccc(F)c(N)c2/C=N/C)cc1OCC(C)C |
| InChI | InChI=1S/C27H28B2F2N4O2/c1-16(2)15-37-24-11-18(19-7-8-22(30)25(32)20(19)12-33-3)10-23(31)21(24)13-35(4)27(28,29)26-17(14-36)6-5-9-34-26/h5-12,14,16H,13,15,32H2,1-4H3/b33-12+ |
| InChIKey | WTIAXVOZJGHQRY-RVDKCFQWSA-N |
| XLogP | 4.08 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.17 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 166076513 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166076513?
The IUPAC name of CID 166076513 (CID 166076513) is not available.
What is the SMILES notation for CID 166076513?
The canonical SMILES for CID 166076513 is [B]C([B])(c1ncccc1C=O)N(C)Cc1c(F)cc(-c2ccc(F)c(N)c2/C=N/C)cc1OCC(C)C.
What is the InChIKey of CID 166076513?
The InChIKey is WTIAXVOZJGHQRY-RVDKCFQWSA-N. The full InChI is InChI=1S/C27H28B2F2N4O2/c1-16(2)15-37-24-11-18(19-7-8-22(30)25(32)20(19)12-33-3)10-23(31)21(24)13-35(4)27(28,29)26-17(14-36)6-5-9-34-26/h5-12,14,16H,13,15,32H2,1-4H3/b33-12+.
What are the key properties of CID 166076513?
CID 166076513 has a molecular weight of 500.17 g/mol, XLogP of 4.08, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166076513 is sourced from PubChem (CID 166076513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).