C25H20F4N4O2 — CID 166076834
6-[[4-[3-amino-2-(methyliminomethyl)phenyl]-2-fluoro-6-(trifluoromethyl)phenyl]methyl]-7-ethenyl-7-hydroxypyrrolo[3,4-b]pyridin-5-one (PubChem CID 166076834) has the molecular formula C25H20F4N4O2 and a molecular weight of 484.45 g/mol. Its IUPAC name is 6-[[4-[3-amino-2-(methyliminomethyl)phenyl]-2-fluoro-6-(trifluoromethyl)phenyl]methyl]-7-ethenyl-7-hydroxypyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[[4-[3-amino-2-(methyliminomethyl)phenyl]-2-fluoro-6-(trifluoromethyl)phenyl]methyl]-7-ethenyl-7-hydroxypyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 166076834 |
| Molecular Formula | C25H20F4N4O2 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 6-[[4-[3-amino-2-(methyliminomethyl)phenyl]-2-fluoro-6-(trifluoromethyl)phenyl]methyl]-7-ethenyl-7-hydroxypyrrolo[3,4-b]pyridin-5-one |
| SMILES | C=CC1(O)c2ncccc2C(=O)N1Cc1c(F)cc(-c2cccc(N)c2/C=N/C)cc1C(F)(F)F |
| InChI | InChI=1S/C25H20F4N4O2/c1-3-24(35)22-16(7-5-9-32-22)23(34)33(24)13-18-19(25(27,28)29)10-14(11-20(18)26)15-6-4-8-21(30)17(15)12-31-2/h3-12,35H,1,13,30H2,2H3/b31-12+ |
| InChIKey | DADUSBSLZPFYBV-KLPHOBTLSA-N |
| XLogP | 4.52 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|