C28H33FN4O4 — CID 166076835
2-[[[4-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-2-fluoro-6-(2-methylpropoxy)phenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde (PubChem CID 166076835) has the molecular formula C28H33FN4O4 and a molecular weight of 508.59 g/mol. Its IUPAC name is 2-[[[4-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-2-fluoro-6-(2-methylpropoxy)phenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde.
| Compound Name | 2-[[[4-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-2-fluoro-6-(2-methylpropoxy)phenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 166076835 |
| Molecular Formula | C28H33FN4O4 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 2-[[[4-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-2-fluoro-6-(2-methylpropoxy)phenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde |
| SMILES | C/N=C/c1c(-c2cc(F)c(CN(C)C(O)(O)c3ncccc3C=O)c(OCC(C)C)c2)ccc(C)c1N |
| InChI | InChI=1S/C28H33FN4O4/c1-17(2)16-37-25-12-20(21-9-8-18(3)26(30)22(21)13-31-4)11-24(29)23(25)14-33(5)28(35,36)27-19(15-34)7-6-10-32-27/h6-13,15,17,35-36H,14,16,30H2,1-5H3/b31-13+ |
| InChIKey | JXWGAOVBHLQTAD-IURWMYGYSA-N |
| XLogP | 3.90 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|