C14H15FN2O3 — CID 166077919
(2E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-fluoroprop-2-enylidene)hexa-3,5-dienamide (PubChem CID 166077919) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is (2E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-fluoroprop-2-enylidene)hexa-3,5-dienamide.
| Compound Name | (2E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-fluoroprop-2-enylidene)hexa-3,5-dienamide |
|---|---|
| PubChem CID | 166077919 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (2E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-fluoroprop-2-enylidene)hexa-3,5-dienamide |
| SMILES | C=CC=C/C(=C\C(=C)F)C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H15FN2O3/c1-3-4-5-10(8-9(2)15)13(19)16-11-6-7-12(18)17-14(11)20/h3-5,8,11H,1-2,6-7H2,(H,16,19)(H,17,18,20)/b5-4?,10-8+ |
| InChIKey | OQWPMNUXYWRMJT-NRQNFYSXSA-N |
| XLogP | 1.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|