About (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine
(2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine (PubChem CID 166077938) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine.
Molecular Properties
| Compound Name | (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine |
| PubChem CID | 166077938 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine |
| SMILES | COC1CC(N2CCN(C)C[C@@H]2C)C1 |
| InChI | InChI=1S/C11H22N2O/c1-9-8-12(2)4-5-13(9)10-6-11(7-10)14-3/h9-11H,4-8H2,1-3H3/t9-,10?,11?/m0/s1 |
| InChIKey | GDFWRUQKAAGULM-WHXUTIOJSA-N |
| XLogP | 0.80 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine?
The IUPAC name of (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine (CID 166077938) is (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine.
What is the SMILES notation for (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine?
The canonical SMILES for (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine is COC1CC(N2CCN(C)C[C@@H]2C)C1.
What is the InChIKey of (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine?
The InChIKey is GDFWRUQKAAGULM-WHXUTIOJSA-N. The full InChI is InChI=1S/C11H22N2O/c1-9-8-12(2)4-5-13(9)10-6-11(7-10)14-3/h9-11H,4-8H2,1-3H3/t9-,10?,11?/m0/s1.
What are the key properties of (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine?
(2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine has a molecular weight of 198.31 g/mol, XLogP of 0.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(3-methoxycyclobutyl)-2,4-dimethylpiperazine is sourced from PubChem (CID 166077938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).