About tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine
tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine (PubChem CID 166077982) has the molecular formula C18H35N3O3
and a molecular weight of 341.50 g/mol. Its IUPAC name is tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine.
Molecular Properties
| Compound Name | tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine |
| PubChem CID | 166077982 |
| Molecular Formula | C18H35N3O3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine |
| SMILES | C1CNCCN1.CC(C)(C)OC(=O)N1CCC(OC2CCC2)CC1 |
| InChI | InChI=1S/C14H25NO3.C4H10N2/c1-14(2,3)18-13(16)15-9-7-12(8-10-15)17-11-5-4-6-11;1-2-6-4-3-5-1/h11-12H,4-10H2,1-3H3;5-6H,1-4H2 |
| InChIKey | MCBFWEKUWMHVMH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine?
The IUPAC name of tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine (CID 166077982) is tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine.
What is the SMILES notation for tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine?
The canonical SMILES for tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine is C1CNCCN1.CC(C)(C)OC(=O)N1CCC(OC2CCC2)CC1.
What is the InChIKey of tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine?
The InChIKey is MCBFWEKUWMHVMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3.C4H10N2/c1-14(2,3)18-13(16)15-9-7-12(8-10-15)17-11-5-4-6-11;1-2-6-4-3-5-1/h11-12H,4-10H2,1-3H3;5-6H,1-4H2.
What are the key properties of tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine?
tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine has a molecular weight of 341.50 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-cyclobutyloxypiperidine-1-carboxylate;piperazine is sourced from PubChem (CID 166077982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).