About (4,4-difluorocyclohexyl)azanium;methanethiol
(4,4-difluorocyclohexyl)azanium;methanethiol (PubChem CID 166078171) has the molecular formula C7H16F2NS+
and a molecular weight of 184.27 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)azanium;methanethiol.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl)azanium;methanethiol |
| PubChem CID | 166078171 |
| Molecular Formula | C7H16F2NS+ |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (4,4-difluorocyclohexyl)azanium;methanethiol |
| SMILES | CS.[NH3+]C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C6H11F2N.CH4S/c7-6(8)3-1-5(9)2-4-6;1-2/h5H,1-4,9H2;2H,1H3/p+1 |
| InChIKey | DJYQHKXKRBOCCQ-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4,4-difluorocyclohexyl)azanium;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl)azanium;methanethiol?
The IUPAC name of (4,4-difluorocyclohexyl)azanium;methanethiol (CID 166078171) is (4,4-difluorocyclohexyl)azanium;methanethiol.
What is the SMILES notation for (4,4-difluorocyclohexyl)azanium;methanethiol?
The canonical SMILES for (4,4-difluorocyclohexyl)azanium;methanethiol is CS.[NH3+]C1CCC(F)(F)CC1.
What is the InChIKey of (4,4-difluorocyclohexyl)azanium;methanethiol?
The InChIKey is DJYQHKXKRBOCCQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H11F2N.CH4S/c7-6(8)3-1-5(9)2-4-6;1-2/h5H,1-4,9H2;2H,1H3/p+1.
What are the key properties of (4,4-difluorocyclohexyl)azanium;methanethiol?
(4,4-difluorocyclohexyl)azanium;methanethiol has a molecular weight of 184.27 g/mol, XLogP of 1.35, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl)azanium;methanethiol is sourced from PubChem (CID 166078171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).