C27H39F3N2O — CID 166078178
(3E,5E)-N-(4,4-difluorocyclohexyl)-2-[[(3Z)-6,6-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-ethylamino]-3-ethenyl-5-fluorohepta-3,5-dienamide (PubChem CID 166078178) has the molecular formula C27H39F3N2O and a molecular weight of 464.62 g/mol. Its IUPAC name is (3E,5E)-N-(4,4-difluorocyclohexyl)-2-[[(3Z)-6,6-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-ethylamino]-3-ethenyl-5-fluorohepta-3,5-dienamide.
| Compound Name | (3E,5E)-N-(4,4-difluorocyclohexyl)-2-[[(3Z)-6,6-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-ethylamino]-3-ethenyl-5-fluorohepta-3,5-dienamide |
|---|---|
| PubChem CID | 166078178 |
| Molecular Formula | C27H39F3N2O |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | (3E,5E)-N-(4,4-difluorocyclohexyl)-2-[[(3Z)-6,6-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-ethylamino]-3-ethenyl-5-fluorohepta-3,5-dienamide |
| SMILES | C=C/C(=C\C(F)=C/C)C(C(=O)NC1CCC(F)(F)CC1)N(CC)C(=C)/C=C\C(=C)C(C)(C)C |
| InChI | InChI=1S/C27H39F3N2O/c1-9-21(18-22(28)10-2)24(25(33)31-23-14-16-27(29,30)17-15-23)32(11-3)20(5)13-12-19(4)26(6,7)8/h9-10,12-13,18,23-24H,1,4-5,11,14-17H2,2-3,6-8H3,(H,31,33)/b13-12-,21-18+,22-10+ |
| InChIKey | BYVIMUKCZIVQOI-ZARQBTEZSA-N |
| XLogP | 7.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|