About CID 166078860
CID 166078860 (PubChem CID 166078860) has the molecular formula C27H29F3N6O3+
and a molecular weight of 542.56 g/mol.
Molecular Properties
| Compound Name | CID 166078860 |
| PubChem CID | 166078860 |
| Molecular Formula | C27H29F3N6O3+ |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | — |
| SMILES | COc1cc(-n2cc3c(C(F)(F)F)cc(CN4CCCC4)cn3c2=O)cc(C2(C[C]3N=NC=[N+]3C)COC2)c1 |
| InChI | InChI=1S/C27H29F3N6O3/c1-33-17-31-32-24(33)11-26(15-39-16-26)19-8-20(10-21(9-19)38-2)35-14-23-22(27(28,29)30)7-18(13-36(23)25(35)37)12-34-5-3-4-6-34/h7-10,13-14,17H,3-6,11-12,15-16H2,1-2H3/q+1 |
| InChIKey | JPGUFBWEFOUQTK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 166078860 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166078860?
The IUPAC name of CID 166078860 (CID 166078860) is not available.
What is the SMILES notation for CID 166078860?
The canonical SMILES for CID 166078860 is COc1cc(-n2cc3c(C(F)(F)F)cc(CN4CCCC4)cn3c2=O)cc(C2(C[C]3N=NC=[N+]3C)COC2)c1.
What is the InChIKey of CID 166078860?
The InChIKey is JPGUFBWEFOUQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29F3N6O3/c1-33-17-31-32-24(33)11-26(15-39-16-26)19-8-20(10-21(9-19)38-2)35-14-23-22(27(28,29)30)7-18(13-36(23)25(35)37)12-34-5-3-4-6-34/h7-10,13-14,17H,3-6,11-12,15-16H2,1-2H3/q+1.
What are the key properties of CID 166078860?
CID 166078860 has a molecular weight of 542.56 g/mol, XLogP of 4.00, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166078860 is sourced from PubChem (CID 166078860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).