C18H32N2 — CID 166079613
ethane;N-methylethenamine;(3E)-4-(5-methylspiro[2.3]hexan-5-yl)hexa-1,3,5-trien-2-amine (PubChem CID 166079613) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is ethane;N-methylethenamine;(3E)-4-(5-methylspiro[2.3]hexan-5-yl)hexa-1,3,5-trien-2-amine.
| Compound Name | ethane;N-methylethenamine;(3E)-4-(5-methylspiro[2.3]hexan-5-yl)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 166079613 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | ethane;N-methylethenamine;(3E)-4-(5-methylspiro[2.3]hexan-5-yl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C/C(=C\C(=C)N)C1(C)CC2(CC2)C1.C=CNC.CC |
| InChI | InChI=1S/C13H19N.C3H7N.C2H6/c1-4-11(7-10(2)14)12(3)8-13(9-12)5-6-13;1-3-4-2;1-2/h4,7H,1-2,5-6,8-9,14H2,3H3;3-4H,1H2,2H3;1-2H3/b11-7+;; |
| InChIKey | GBIZYZWVDYRSJY-FCVAESPPSA-N |
| XLogP | 4.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|