About CID 166080028
CID 166080028 (PubChem CID 166080028) has the molecular formula C30H32F3N9O+2
and a molecular weight of 591.64 g/mol.
Molecular Properties
| Compound Name | CID 166080028 |
| PubChem CID | 166080028 |
| Molecular Formula | C30H32F3N9O+2 |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | — |
| SMILES | C[N+]1=CN=N[C]1[C@@H](c1cccc(-n2cc3c(C(F)(F)F)cc(CN4CCCC([N+]5=CN=N[CH]5)C4)cn3c2=O)c1)C1CCC1 |
| InChI | InChI=1S/C30H32F3N9O/c1-38-17-36-37-28(38)27(21-5-2-6-21)22-7-3-8-23(12-22)41-16-26-25(30(31,32)33)11-20(14-42(26)29(41)43)13-39-10-4-9-24(15-39)40-18-34-35-19-40/h3,7-8,11-12,14,16-19,21,24,27H,2,4-6,9-10,13,15H2,1H3/q+2/t24?,27-/m1/s1 |
| InChIKey | FBRXVWOAUCZHKB-LFHRXCRSSA-N |
| XLogP | 5.21 |
| TPSA | 85.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 166080028 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166080028?
The IUPAC name of CID 166080028 (CID 166080028) is not available.
What is the SMILES notation for CID 166080028?
The canonical SMILES for CID 166080028 is C[N+]1=CN=N[C]1[C@@H](c1cccc(-n2cc3c(C(F)(F)F)cc(CN4CCCC([N+]5=CN=N[CH]5)C4)cn3c2=O)c1)C1CCC1.
What is the InChIKey of CID 166080028?
The InChIKey is FBRXVWOAUCZHKB-LFHRXCRSSA-N. The full InChI is InChI=1S/C30H32F3N9O/c1-38-17-36-37-28(38)27(21-5-2-6-21)22-7-3-8-23(12-22)41-16-26-25(30(31,32)33)11-20(14-42(26)29(41)43)13-39-10-4-9-24(15-39)40-18-34-35-19-40/h3,7-8,11-12,14,16-19,21,24,27H,2,4-6,9-10,13,15H2,1H3/q+2/t24?,27-/m1/s1.
What are the key properties of CID 166080028?
CID 166080028 has a molecular weight of 591.64 g/mol, XLogP of 5.21, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166080028 is sourced from PubChem (CID 166080028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).