About CID 166080318
CID 166080318 (PubChem CID 166080318) has the molecular formula C27H28F3N7O2+
and a molecular weight of 539.56 g/mol.
Molecular Properties
| Compound Name | CID 166080318 |
| PubChem CID | 166080318 |
| Molecular Formula | C27H28F3N7O2+ |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | — |
| SMILES | CN1C(=O)CCN1Cc1cc(C(F)(F)F)c2cn(-c3cccc([C@H]([C]4N=NC=[N+]4C)C4CCC4)c3)c(=O)n2c1 |
| InChI | InChI=1S/C27H28F3N7O2/c1-33-16-31-32-25(33)24(18-5-3-6-18)19-7-4-8-20(12-19)36-15-22-21(27(28,29)30)11-17(14-37(22)26(36)39)13-35-10-9-23(38)34(35)2/h4,7-8,11-12,14-16,18,24H,3,5-6,9-10,13H2,1-2H3/q+1/t24-/m1/s1 |
| InChIKey | WQFIRDCXZYFYPX-XMMPIXPASA-N |
| XLogP | 4.20 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 166080318 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166080318?
The IUPAC name of CID 166080318 (CID 166080318) is not available.
What is the SMILES notation for CID 166080318?
The canonical SMILES for CID 166080318 is CN1C(=O)CCN1Cc1cc(C(F)(F)F)c2cn(-c3cccc([C@H]([C]4N=NC=[N+]4C)C4CCC4)c3)c(=O)n2c1.
What is the InChIKey of CID 166080318?
The InChIKey is WQFIRDCXZYFYPX-XMMPIXPASA-N. The full InChI is InChI=1S/C27H28F3N7O2/c1-33-16-31-32-25(33)24(18-5-3-6-18)19-7-4-8-20(12-19)36-15-22-21(27(28,29)30)11-17(14-37(22)26(36)39)13-35-10-9-23(38)34(35)2/h4,7-8,11-12,14-16,18,24H,3,5-6,9-10,13H2,1-2H3/q+1/t24-/m1/s1.
What are the key properties of CID 166080318?
CID 166080318 has a molecular weight of 539.56 g/mol, XLogP of 4.20, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166080318 is sourced from PubChem (CID 166080318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).