C25H24N2O3 — CID 16608038
[1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16608038) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is [1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16608038 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1cccc2cccnc12)C(=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C25H24N2O3/c1-17(25(29)27-22-13-5-8-18-7-2-3-12-21(18)22)30-23(28)15-14-20-10-4-9-19-11-6-16-26-24(19)20/h2-4,6-7,9-12,14-17,22H,5,8,13H2,1H3,(H,27,29)/b15-14+ |
| InChIKey | RTPRCTCLIDWMJQ-CCEZHUSRSA-N |
| XLogP | 4.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|