C33H39ClF4N6O — CID 166080648
5-chloro-4-[6,8-difluoro-2-methoxy-4-(3-methylpiperazin-1-yl)quinazolin-7-yl]-1-fluoronaphthalen-2-amine;ethane;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 166080648) has the molecular formula C33H39ClF4N6O and a molecular weight of 647.16 g/mol. Its IUPAC name is 5-chloro-4-[6,8-difluoro-2-methoxy-4-(3-methylpiperazin-1-yl)quinazolin-7-yl]-1-fluoronaphthalen-2-amine;ethane;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 5-chloro-4-[6,8-difluoro-2-methoxy-4-(3-methylpiperazin-1-yl)quinazolin-7-yl]-1-fluoronaphthalen-2-amine;ethane;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 166080648 |
| Molecular Formula | C33H39ClF4N6O |
| Molecular Weight | 647.16 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | 5-chloro-4-[6,8-difluoro-2-methoxy-4-(3-methylpiperazin-1-yl)quinazolin-7-yl]-1-fluoronaphthalen-2-amine;ethane;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | CC.COc1nc(N2CCNC(C)C2)c2cc(F)c(-c3cc(N)c(F)c4cccc(Cl)c34)c(F)c2n1.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C24H21ClF3N5O.C7H12FN.C2H6/c1-11-10-33(7-6-30-11)23-14-8-16(26)19(21(28)22(14)31-24(32-23)34-2)13-9-17(29)20(27)12-4-3-5-15(25)18(12)13;8-6-4-7-2-1-3-9(7)5-6;1-2/h3-5,8-9,11,30H,6-7,10,29H2,1-2H3;6-7H,1-5H2;1-2H3 |
| InChIKey | ACOZXKZLIDCYPT-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.16 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|